Sulfonyl halides
eMolecules 942474-45-5 | 4-Methanesulfonyl-3-(morpholin-4-yl)aniline | Combi-Blocks | MFCD09027709 | 256.320 | C11H16N2O3S | 97.000 | CS(=O)(=O)c1ccc(N)cc1N1CCOCC1 | 1g | 232301405
4-Methanesulfonyl-3-(morpholin-4-yl)aniline | Combi-Blocks | 942474-45-5 | MFCD09027709 | 256.320 | C11H16N2O3S | 97.000 | CS(=O)(=O)c1ccc(N)cc1N1CCOCC1 | 1g | 232301405
Medchemexpress LLC Dichloroiodomethane | 594-04-7 | MFCD30720198 | 95.0% | 210.83 g/mol | CHCl2I | 5 MG
Dichloroiodomethane (CAS 594-04-7) is an endogenous trihalomethane supplied as a small-volume laboratory reagent. It is provided as a colored liquid solution in ethanol at 95.0% purity and prepared to 10 mM concentration for convenient use. The material should be stored protected from light and handled according to supplied safety documentation.
Aobchem 1-(2-(2-Methyl-1 3-dioxolan-2-yl)thiazol-5-yl)ethanone | 95% | C9H11NO3S | 500mg
1-(2-(2-Methyl-1 3-dioxolan-2-yl)thiazol-5-yl)ethanone | 95% | C9H11NO3S | 500mg
Medchemexpress LLC Datelliptium (chloride) | 105118-14-7 | 397.94 | 25 MG
Datelliptium chloride is a DNA-intercalating agent derived from ellipticine, known for its anti-tumor activities. It demonstrates significant cytotoxic effects in various cell systems.
- DNA-intercalating agent
- Exhibits anti-tumor activities
- Demonstrates significant cytotoxic effects
- Mobilizes glycogen in rat hepatocytes
- Decreases gluconeogenesis from lactate
- Selectively cytotoxic for solid tumors
Medchemexpress LLC Trigonelline chloride | 6138-41-6 | 173.60 | 1 ML
Trigonelline chloride is an alkaloid isolated from *Trigonella foenum-graecum* L or *Leonurus artemisia* with potential antidiabetic activity. It functions as a potent Nrf2 inhibitor, blocking Nrf2-dependent proteasome activity to enhance apoptosis in pancreatic cancer cells. It also demonstrates anti-HSV-1, antibacterial, and antifungal properties, and induces ferroptosis. In vitro, it helps rescue H9c2 cell morphology and attenuates H2O2-induced cell deaths, improving antioxidant activity and regulating apoptotic genes.
- Potential antidiabetic activity
- Potent Nrf2 inhibitor, enhancing apoptosis in cancer cells
- Anti-HSV-1, antibacterial, and antifungal activities
- Induces ferroptosis
- Improves antioxidant activity and regulates apoptotic genes
- Affects skeletal system, with varying impacts based on metabolic disorder models
eMolecules 27757-86-4 | THIOPHEN-3-YLMETHANAMINE | AstaTech | MFCD01529872 | 113.180 | C5H7NS | 95.000 | NCc1ccsc1 | 1g | 233614764
THIOPHEN-3-YLMETHANAMINE | AstaTech | 27757-86-4 | MFCD01529872 | 113.180 | C5H7NS | 95.000 | NCc1ccsc1 | 1g | 233614764
eMolecules 38220-75-6 | 1-(5-Bromo-1-benzofuran-2-yl)ethanone | Apollo Scientific | MFCD00276737 | 239.068 | C10H7BrO2 | 95.000 | CC(=O)c1cc2cc(Br)ccc2o1 | 5g | 562460098
1-(5-Bromo-1-benzofuran-2-yl)ethanone | Apollo Scientific | 38220-75-6 | MFCD00276737 | 239.068 | C10H7BrO2 | 95.000 | CC(=O)c1cc2cc(Br)ccc2o1 | 5g | 562460098
eMolecules 54322-65-5 | 2-CYCLOPROPYLACETYL CHLORIDE | AstaTech | MFCD11110393 | 118.560 | C5H7ClO | 95.000 | ClC(=O)CC1CC1 | 1g | 454130285
2-CYCLOPROPYLACETYL CHLORIDE | AstaTech | 54322-65-5 | MFCD11110393 | 118.560 | C5H7ClO | 95.000 | ClC(=O)CC1CC1 | 1g | 454130285
eMolecules 1-(3-Bromo-1-benzofuran-2-yl)-1-ethanone | 99661-02-6 | MFCD09972223 | 1g
Matrix Scientific | 1-(3-Bromo-1-benzofuran-2-yl)-1-ethanone | 1g | 389721313 | 46207 | 95.000 | 99661-02-6 | MFCD09972223 | 239.068 | C10H7BrO2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 241134-35-0 | 1-Methanesulfonyl-piperidine-4-carbaldehyde | J & W PharmLab LLC | MFCD11582937 | 191.250 | C7H13NO3S | 96.000 | CS(=O)(=O)N1CCC(CC1)C=O | 5g | 289353874
1-Methanesulfonyl-piperidine-4-carbaldehyde | J & W PharmLab LLC | 241134-35-0 | MFCD11582937 | 191.250 | C7H13NO3S | 96.000 | CS(=O)(=O)N1CCC(CC1)C=O | 5g | 289353874
eMolecules 616-83-1 | Ambeed | 4-Methyl-3-nitrobenzene-1-sulfonyl chloride | 1g | 625594005 | A241972 | MFCD00129811 | 235.64 | C7H6ClNO4S
Ambeed | 4-Methyl-3-nitrobenzene-1-sulfonyl chloride | 1g | 625594005 | A241972 | 616-83-1 | MFCD00129811 | 235.640 | C7H6ClNO4S
eMolecules 139631-62-2 | cyclopropanesulfonyl chloride | Pharmablock | MFCD01631933 | 140.580 | C3H5ClO2S | 97.000 | ClS(=O)(=O)C1CC1 | 50mg | 551151408
cyclopropanesulfonyl chloride | Pharmablock | 139631-62-2 | MFCD01631933 | 140.580 | C3H5ClO2S | 97.000 | ClS(=O)(=O)C1CC1 | 50mg | 551151408
eMolecules 216159-03-4 | 4-Bromo-2-fluorobenzenesulfonyl chloride | Ambeed | MFCD01090993 | 273.500 | C6H3BrClFO2S | 98.000 | Fc1cc(Br)ccc1S(Cl)(=O)=O | 1g | 491678254
4-Bromo-2-fluorobenzenesulfonyl chloride | Ambeed | 216159-03-4 | MFCD01090993 | 273.500 | C6H3BrClFO2S | 98.000 | Fc1cc(Br)ccc1S(Cl)(=O)=O | 1g | 491678254
eMolecules 1554072-83-1 | 5-methanesulfonyl-1H-indole-3-carboxylic acid | MFCD26764441 | 1g
ChemScene | 7-Chloro-23-dihydroquinolin-4(1H)-one | 100mg | 626491740 | CS-0043080 | 21617-15-2 | MFCD00795494 | 181.620 | C9H8ClNO
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
Aobchem 1-Bromo-5-(1 3-dioxolan-2-yl)-2-methoxybenzene | ≥95% | CAS 223418-72-2 | C10H11BrO3 | 250mg
1-Bromo-5-(1 3-dioxolan-2-yl)-2-methoxybenzene | ≥95% | CAS 223418-72-2 | C10H11BrO3 | 250mg